C23H18ClN3O2 — CID 25392249
1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(3-ethynylanilino)ethanone (PubChem CID 25392249) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(3-ethynylanilino)ethanone.
| Compound Name | 1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(3-ethynylanilino)ethanone |
|---|---|
| PubChem CID | 25392249 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-[(3S)-5-(4-chlorophenyl)-3-(furan-2-yl)-3,4-dihydropyrazol-2-yl]-2-(3-ethynylanilino)ethanone |
| SMILES | C#Cc1cccc(NCC(=O)N2N=C(c3ccc(Cl)cc3)C[C@H]2c2ccco2)c1 |
| InChI | InChI=1S/C23H18ClN3O2/c1-2-16-5-3-6-19(13-16)25-15-23(28)27-21(22-7-4-12-29-22)14-20(26-27)17-8-10-18(24)11-9-17/h1,3-13,21,25H,14-15H2/t21-/m0/s1 |
| InChIKey | DZAFOICBQALYFR-NRFANRHFSA-N |
| XLogP | 4.70 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|