C24H33N3O5S — CID 25393006
(2S)-N-[4-(diethylamino)phenyl]-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanamide (PubChem CID 25393006) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is (2S)-N-[4-(diethylamino)phenyl]-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanamide.
| Compound Name | (2S)-N-[4-(diethylamino)phenyl]-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 25393006 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (2S)-N-[4-(diethylamino)phenyl]-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-3-methylbutanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)[C@@H](NS(=O)(=O)c2ccc3c(c2)OCCCO3)C(C)C)cc1 |
| InChI | InChI=1S/C24H33N3O5S/c1-5-27(6-2)19-10-8-18(9-11-19)25-24(28)23(17(3)4)26-33(29,30)20-12-13-21-22(16-20)32-15-7-14-31-21/h8-13,16-17,23,26H,5-7,14-15H2,1-4H3,(H,25,28)/t23-/m0/s1 |
| InChIKey | YCUFIXVNZXUAQB-QHCPKHFHSA-N |
| XLogP | 3.64 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|