C18H27N3O6 — CID 2539303
[2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate (PubChem CID 2539303) has the molecular formula C18H27N3O6 and a molecular weight of 381.43 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 2539303 |
| Molecular Formula | C18H27N3O6 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoate |
| SMILES | CC(C)(C)NC(=O)NC(=O)COC(=O)CCN1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C18H27N3O6/c1-18(2,3)20-17(26)19-13(22)10-27-14(23)8-9-21-15(24)11-6-4-5-7-12(11)16(21)25/h11-12H,4-10H2,1-3H3,(H2,19,20,22,26)/t11-,12+ |
| InChIKey | RVHYTPDRNPITOR-TXEJJXNPSA-N |
| XLogP | 0.72 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|