C26H33N5O2S — CID 25394447
N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 25394447) has the molecular formula C26H33N5O2S and a molecular weight of 479.65 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 25394447 |
| Molecular Formula | C26H33N5O2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-[[5-methyl-4-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | Cc1ccc(-n2c(C)nnc2SCC(=O)N(Cc2ccc(N(C)C)cc2)C[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C26H33N5O2S/c1-19-7-11-23(12-8-19)31-20(2)27-28-26(31)34-18-25(32)30(17-24-6-5-15-33-24)16-21-9-13-22(14-10-21)29(3)4/h7-14,24H,5-6,15-18H2,1-4H3/t24-/m0/s1 |
| InChIKey | UKMAKJMDYQBQCJ-DEOSSOPVSA-N |
| XLogP | 4.25 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|