C17H19ClN2O2 — CID 25396302
(4R)-1-[2-(3-chlorophenyl)ethyl]-4-(furan-3-ylmethylamino)pyrrolidin-2-one (PubChem CID 25396302) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is (4R)-1-[2-(3-chlorophenyl)ethyl]-4-(furan-3-ylmethylamino)pyrrolidin-2-one.
| Compound Name | (4R)-1-[2-(3-chlorophenyl)ethyl]-4-(furan-3-ylmethylamino)pyrrolidin-2-one |
|---|---|
| PubChem CID | 25396302 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (4R)-1-[2-(3-chlorophenyl)ethyl]-4-(furan-3-ylmethylamino)pyrrolidin-2-one |
| SMILES | O=C1C[C@@H](NCc2ccoc2)CN1CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H19ClN2O2/c18-15-3-1-2-13(8-15)4-6-20-11-16(9-17(20)21)19-10-14-5-7-22-12-14/h1-3,5,7-8,12,16,19H,4,6,9-11H2/t16-/m1/s1 |
| InChIKey | FYLPSGVHHJTFRS-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |