C25H34N4O3S — CID 25398811
N-[(6S)-3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 25398811) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is N-[(6S)-3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[(6S)-3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 25398811 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N-[(6S)-3-cyano-6-(2-methylbutan-2-yl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCC(C)(C)[C@H]1CCc2c(sc(NC(=O)CN3C(=O)NC4(CCC(C)CC4)C3=O)c2C#N)C1 |
| InChI | InChI=1S/C25H34N4O3S/c1-5-24(3,4)16-6-7-17-18(13-26)21(33-19(17)12-16)27-20(30)14-29-22(31)25(28-23(29)32)10-8-15(2)9-11-25/h15-16H,5-12,14H2,1-4H3,(H,27,30)(H,28,32)/t15?,16-,25?/m0/s1 |
| InChIKey | YUMAOHYJVLIWPF-BUAFLGJXSA-N |
| XLogP | 4.60 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|