About 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one
2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one (PubChem CID 25400595) has the molecular formula C23H27NO4
and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one |
| PubChem CID | 25400595 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one |
| SMILES | CCOc1cc2c(=O)oc(-c3ccc(C(C)C)cc3C(C)C)nc2cc1OC |
| InChI | InChI=1S/C23H27NO4/c1-7-27-21-11-18-19(12-20(21)26-6)24-22(28-23(18)25)16-9-8-15(13(2)3)10-17(16)14(4)5/h8-14H,7H2,1-6H3 |
| InChIKey | PAOGPONYKUTTHZ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one?
The IUPAC name of 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one (CID 25400595) is 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one?
The canonical SMILES for 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one is CCOc1cc2c(=O)oc(-c3ccc(C(C)C)cc3C(C)C)nc2cc1OC.
What is the InChIKey of 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one?
The InChIKey is PAOGPONYKUTTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO4/c1-7-27-21-11-18-19(12-20(21)26-6)24-22(28-23(18)25)16-9-8-15(13(2)3)10-17(16)14(4)5/h8-14H,7H2,1-6H3.
What are the key properties of 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one?
2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one has a molecular weight of 381.47 g/mol, XLogP of 5.51, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4-di(propan-2-yl)phenyl]-6-ethoxy-7-methoxy-3,1-benzoxazin-4-one is sourced from PubChem (CID 25400595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).