C20H16N2O6 — CID 2540215
1-benzyl-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione (PubChem CID 2540215) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-benzyl-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-benzyl-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 2540215 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-benzyl-3-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]imidazolidine-2,4,5-trione |
| SMILES | O=C(CN1C(=O)C(=O)N(Cc2ccccc2)C1=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C20H16N2O6/c23-15(14-6-7-16-17(10-14)28-9-8-27-16)12-22-19(25)18(24)21(20(22)26)11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2 |
| InChIKey | WBHVIFFFODUPIY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|