About [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate (PubChem CID 2540712) has the molecular formula C20H20N2O5
and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate |
| PubChem CID | 2540712 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate |
| SMILES | O=C1CN(C(=O)COC(=O)CCCOc2ccccc2)c2ccccc2N1 |
| InChI | InChI=1S/C20H20N2O5/c23-18-13-22(17-10-5-4-9-16(17)21-18)19(24)14-27-20(25)11-6-12-26-15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2,(H,21,23) |
| InChIKey | QKYJRDQBOXAVGT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate?
The IUPAC name of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate (CID 2540712) is [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate.
What is the SMILES notation for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate?
The canonical SMILES for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate is O=C1CN(C(=O)COC(=O)CCCOc2ccccc2)c2ccccc2N1.
What is the InChIKey of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate?
The InChIKey is QKYJRDQBOXAVGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O5/c23-18-13-22(17-10-5-4-9-16(17)21-18)19(24)14-27-20(25)11-6-12-26-15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2,(H,21,23).
What are the key properties of [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate?
[2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate has a molecular weight of 368.39 g/mol, XLogP of 2.37, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-oxo-2,4-dihydroquinoxalin-1-yl)ethyl] 4-phenoxybutanoate is sourced from PubChem (CID 2540712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).