C26H28ClN3O3S — CID 25407688
2-chloro-5-[(3-methylphenyl)sulfamoyl]-N-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]benzamide (PubChem CID 25407688) has the molecular formula C26H28ClN3O3S and a molecular weight of 498.05 g/mol. Its IUPAC name is 2-chloro-5-[(3-methylphenyl)sulfamoyl]-N-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]benzamide.
| Compound Name | 2-chloro-5-[(3-methylphenyl)sulfamoyl]-N-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 25407688 |
| Molecular Formula | C26H28ClN3O3S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2-chloro-5-[(3-methylphenyl)sulfamoyl]-N-[(2R)-2-phenyl-2-pyrrolidin-1-ylethyl]benzamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(Cl)c(C(=O)NC[C@@H](c3ccccc3)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C26H28ClN3O3S/c1-19-8-7-11-21(16-19)29-34(32,33)22-12-13-24(27)23(17-22)26(31)28-18-25(30-14-5-6-15-30)20-9-3-2-4-10-20/h2-4,7-13,16-17,25,29H,5-6,14-15,18H2,1H3,(H,28,31)/t25-/m0/s1 |
| InChIKey | WTQLKSCMTAVJPW-VWLOTQADSA-N |
| XLogP | 5.02 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |