About [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate
[2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2540862) has the molecular formula C19H15N3O6
and a molecular weight of 381.34 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
Molecular Properties
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| PubChem CID | 2540862 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | NC(=O)NC(=O)COC(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C19H15N3O6/c20-19(27)21-15(23)10-28-18(26)12-6-7-13-14(8-12)17(25)22(16(13)24)9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H3,20,21,23,27) |
| InChIKey | LBUDXZSQQXHSEW-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate?
The IUPAC name of [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate (CID 2540862) is [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate.
What is the SMILES notation for [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate?
The canonical SMILES for [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate is NC(=O)NC(=O)COC(=O)c1ccc2c(c1)C(=O)N(Cc1ccccc1)C2=O.
What is the InChIKey of [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate?
The InChIKey is LBUDXZSQQXHSEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O6/c20-19(27)21-15(23)10-28-18(26)12-6-7-13-14(8-12)17(25)22(16(13)24)9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H3,20,21,23,27).
What are the key properties of [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate?
[2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate has a molecular weight of 381.34 g/mol, XLogP of 0.83, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(carbamoylamino)-2-oxoethyl] 2-benzyl-1,3-dioxoisoindole-5-carboxylate is sourced from PubChem (CID 2540862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).