About 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one
4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one (PubChem CID 2541322) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one.
Molecular Properties
| Compound Name | 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one |
| PubChem CID | 2541322 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one |
| SMILES | O=C1CN(Cc2cc(=O)oc3cc4c(cc23)CCC4)CCN1 |
| InChI | InChI=1S/C17H18N2O3/c20-16-10-19(5-4-18-16)9-13-8-17(21)22-15-7-12-3-1-2-11(12)6-14(13)15/h6-8H,1-5,9-10H2,(H,18,20) |
| InChIKey | GVNOSYYZDLGDHX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one?
The IUPAC name of 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one (CID 2541322) is 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one.
What is the SMILES notation for 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one?
The canonical SMILES for 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one is O=C1CN(Cc2cc(=O)oc3cc4c(cc23)CCC4)CCN1.
What is the InChIKey of 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one?
The InChIKey is GVNOSYYZDLGDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c20-16-10-19(5-4-18-16)9-13-8-17(21)22-15-7-12-3-1-2-11(12)6-14(13)15/h6-8H,1-5,9-10H2,(H,18,20).
What are the key properties of 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one?
4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one has a molecular weight of 298.34 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]piperazin-2-one is sourced from PubChem (CID 2541322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).