C18H20BrFN2O — CID 2541418
2-[(4-bromophenyl)methyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 2541418) has the molecular formula C18H20BrFN2O and a molecular weight of 379.27 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[(4-bromophenyl)methyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 2541418 |
| Molecular Formula | C18H20BrFN2O |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 2-[(4-bromophenyl)methyl-methylamino]-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CN(CC(=O)NCCc1ccc(F)cc1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrFN2O/c1-22(12-15-2-6-16(19)7-3-15)13-18(23)21-11-10-14-4-8-17(20)9-5-14/h2-9H,10-13H2,1H3,(H,21,23) |
| InChIKey | ORAXWZJYFAYEQJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |