C20H21NO5 — CID 2541651
[2-(2-ethoxyanilino)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate (PubChem CID 2541651) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is [2-(2-ethoxyanilino)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(2-ethoxyanilino)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2541651 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [2-(2-ethoxyanilino)-2-oxoethyl] (E)-3-(2-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccccc1NC(=O)COC(=O)/C=C/c1ccccc1OC |
| InChI | InChI=1S/C20H21NO5/c1-3-25-18-11-7-5-9-16(18)21-19(22)14-26-20(23)13-12-15-8-4-6-10-17(15)24-2/h4-13H,3,14H2,1-2H3,(H,21,22)/b13-12+ |
| InChIKey | QHAUBKOFUAQPCF-OUKQBFOZSA-N |
| XLogP | 3.29 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|