C9H11FN2 — CID 25418469
7-fluoro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine (PubChem CID 25418469) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is 7-fluoro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine.
| Compound Name | 7-fluoro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 25418469 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 7-fluoro-2,3,4,5-tetrahydro-1H-1,4-benzodiazepine |
| SMILES | Fc1ccc2c(c1)CNCCN2 |
| InChI | InChI=1S/C9H11FN2/c10-8-1-2-9-7(5-8)6-11-3-4-12-9/h1-2,5,11-12H,3-4,6H2 |
| InChIKey | NNXGSKKLUSOLHT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |