7-chloro-1H-indole-3-carboxylic acid

C9H6ClNO2 — CID 25418670

IUPAC7-chloro-1H-indole-3-carboxylic acid
SMILESO=C(O)c1c[nH]c2c(Cl)cccc12
InChIInChI=1S/C9H6ClNO2/c10-7-3-1-2-5-6(9(12)13)4-11-8(5)7/h1-4,11H,(H,12,13)
InChIKeyDBCJWTBYVXEBJY-UHFFFAOYSA-N
MW195.61 g/mol
LogP2.52
Rot. Bonds1

About 7-chloro-1H-indole-3-carboxylic acid

7-chloro-1H-indole-3-carboxylic acid (PubChem CID 25418670) has the molecular formula C9H6ClNO2 and a molecular weight of 195.61 g/mol. Its IUPAC name is 7-chloro-1H-indole-3-carboxylic acid.

Molecular Properties

Compound Name7-chloro-1H-indole-3-carboxylic acid
PubChem CID25418670
Molecular FormulaC9H6ClNO2
Molecular Weight195.61 g/mol
Exact Mass195.01
IUPAC Name7-chloro-1H-indole-3-carboxylic acid
SMILESO=C(O)c1c[nH]c2c(Cl)cccc12
InChIInChI=1S/C9H6ClNO2/c10-7-3-1-2-5-6(9(12)13)4-11-8(5)7/h1-4,11H,(H,12,13)
InChIKeyDBCJWTBYVXEBJY-UHFFFAOYSA-N
XLogP2.52
TPSA53.09 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.61
LogP ≤ 52.52
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze 7-chloro-1H-indole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-chloro-1H-indole-3-carboxylic acid?
The IUPAC name of 7-chloro-1H-indole-3-carboxylic acid (CID 25418670) is 7-chloro-1H-indole-3-carboxylic acid.
What is the SMILES notation for 7-chloro-1H-indole-3-carboxylic acid?
The canonical SMILES for 7-chloro-1H-indole-3-carboxylic acid is O=C(O)c1c[nH]c2c(Cl)cccc12.
What is the InChIKey of 7-chloro-1H-indole-3-carboxylic acid?
The InChIKey is DBCJWTBYVXEBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNO2/c10-7-3-1-2-5-6(9(12)13)4-11-8(5)7/h1-4,11H,(H,12,13).
What are the key properties of 7-chloro-1H-indole-3-carboxylic acid?
7-chloro-1H-indole-3-carboxylic acid has a molecular weight of 195.61 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1H-indole-3-carboxylic acid is sourced from PubChem (CID 25418670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).