About 5-methoxy-1,2-oxazole-4-carboxylic acid
5-methoxy-1,2-oxazole-4-carboxylic acid (PubChem CID 25418693) has the molecular formula C5H5NO4
and a molecular weight of 143.10 g/mol. Its IUPAC name is 5-methoxy-1,2-oxazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-methoxy-1,2-oxazole-4-carboxylic acid |
| PubChem CID | 25418693 |
| Molecular Formula | C5H5NO4 |
| Molecular Weight | 143.10 g/mol |
| Exact Mass | 143.02 |
| IUPAC Name | 5-methoxy-1,2-oxazole-4-carboxylic acid |
| SMILES | COc1oncc1C(=O)O |
| InChI | InChI=1S/C5H5NO4/c1-9-5-3(4(7)8)2-6-10-5/h2H,1H3,(H,7,8) |
| InChIKey | OAYYFPLKGYOFKA-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.10 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-1,2-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-methoxy-1,2-oxazole-4-carboxylic acid (CID 25418693) is 5-methoxy-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-methoxy-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-methoxy-1,2-oxazole-4-carboxylic acid is COc1oncc1C(=O)O.
What is the InChIKey of 5-methoxy-1,2-oxazole-4-carboxylic acid?
The InChIKey is OAYYFPLKGYOFKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO4/c1-9-5-3(4(7)8)2-6-10-5/h2H,1H3,(H,7,8).
What are the key properties of 5-methoxy-1,2-oxazole-4-carboxylic acid?
5-methoxy-1,2-oxazole-4-carboxylic acid has a molecular weight of 143.10 g/mol, XLogP of 0.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 25418693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).