About (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide
(2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 2541970) has the molecular formula C18H20N2O4S
and a molecular weight of 360.44 g/mol. Its IUPAC name is (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| PubChem CID | 2541970 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H]2CCCN2C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-23-12-7-8-15(24-2)13(11-12)19-17(21)14-5-3-9-20(14)18(22)16-6-4-10-25-16/h4,6-8,10-11,14H,3,5,9H2,1-2H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | REHGFFUOVMHVFG-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide?
The IUPAC name of (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (CID 2541970) is (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
What is the SMILES notation for (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide?
The canonical SMILES for (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide is COc1ccc(OC)c(NC(=O)[C@@H]2CCCN2C(=O)c2cccs2)c1.
What is the InChIKey of (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide?
The InChIKey is REHGFFUOVMHVFG-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H20N2O4S/c1-23-12-7-8-15(24-2)13(11-12)19-17(21)14-5-3-9-20(14)18(22)16-6-4-10-25-16/h4,6-8,10-11,14H,3,5,9H2,1-2H3,(H,19,21)/t14-/m0/s1.
What are the key properties of (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide?
(2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide has a molecular weight of 360.44 g/mol, XLogP of 3.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(2,5-dimethoxyphenyl)-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide is sourced from PubChem (CID 2541970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).