C7H10N2O2S — CID 25421254
6-hydroxy-5-propan-2-yl-2-sulfanylidene-1H-pyrimidin-4-one (PubChem CID 25421254) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 6-hydroxy-5-propan-2-yl-2-sulfanylidene-1H-pyrimidin-4-one.
| Compound Name | 6-hydroxy-5-propan-2-yl-2-sulfanylidene-1H-pyrimidin-4-one |
|---|---|
| PubChem CID | 25421254 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 6-hydroxy-5-propan-2-yl-2-sulfanylidene-1H-pyrimidin-4-one |
| SMILES | CC(C)c1c(O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C7H10N2O2S/c1-3(2)4-5(10)8-7(12)9-6(4)11/h3H,1-2H3,(H3,8,9,10,11,12) |
| InChIKey | TWEYMXYSHLKCOO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|