C21H22N4O — CID 2542208
azepan-1-yl-(1,5-diphenyl-1,2,4-triazol-3-yl)methanone (PubChem CID 2542208) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is azepan-1-yl-(1,5-diphenyl-1,2,4-triazol-3-yl)methanone.
| Compound Name | azepan-1-yl-(1,5-diphenyl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 2542208 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | azepan-1-yl-(1,5-diphenyl-1,2,4-triazol-3-yl)methanone |
| SMILES | O=C(c1nc(-c2ccccc2)n(-c2ccccc2)n1)N1CCCCCC1 |
| InChI | InChI=1S/C21H22N4O/c26-21(24-15-9-1-2-10-16-24)19-22-20(17-11-5-3-6-12-17)25(23-19)18-13-7-4-8-14-18/h3-8,11-14H,1-2,9-10,15-16H2 |
| InChIKey | LJIQJJVIEDLDCD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |