About 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one
4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one (PubChem CID 2542254) has the molecular formula C15H18N2O4
and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one.
Molecular Properties
| Compound Name | 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one |
| PubChem CID | 2542254 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCNC(=O)C2)c(OC)c1 |
| InChI | InChI=1S/C15H18N2O4/c1-20-12-5-3-11(13(9-12)21-2)4-6-15(19)17-8-7-16-14(18)10-17/h3-6,9H,7-8,10H2,1-2H3,(H,16,18)/b6-4+ |
| InChIKey | UXSGOBFVGPXNDM-GQCTYLIASA-N |
| XLogP | 0.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one?
The IUPAC name of 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one (CID 2542254) is 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one.
What is the SMILES notation for 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one?
The canonical SMILES for 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one is COc1ccc(/C=C/C(=O)N2CCNC(=O)C2)c(OC)c1.
What is the InChIKey of 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one?
The InChIKey is UXSGOBFVGPXNDM-GQCTYLIASA-N. The full InChI is InChI=1S/C15H18N2O4/c1-20-12-5-3-11(13(9-12)21-2)4-6-15(19)17-8-7-16-14(18)10-17/h3-6,9H,7-8,10H2,1-2H3,(H,16,18)/b6-4+.
What are the key properties of 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one?
4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one has a molecular weight of 290.32 g/mol, XLogP of 0.68, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-3-(2,4-dimethoxyphenyl)prop-2-enoyl]piperazin-2-one is sourced from PubChem (CID 2542254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).