[(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate

C13H12N2O4 — CID 25424819

IUPAC[(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate
SMILESO=C(Cn1cnc2ccccc21)O[C@@H]1CCOC1=O
InChIInChI=1S/C13H12N2O4/c16-12(19-11-5-6-18-13(11)17)7-15-8-14-9-3-1-2-4-10(9)15/h1-4,8,11H,5-7H2/t11-/m1/s1
InChIKeyYRMPBISOOYFGME-LLVKDONJSA-N
MW260.25 g/mol
LogP0.89
Rot. Bonds3

About [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate

[(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate (PubChem CID 25424819) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate.

Molecular Properties

Compound Name[(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate
PubChem CID25424819
Molecular FormulaC13H12N2O4
Molecular Weight260.25 g/mol
Exact Mass260.08
IUPAC Name[(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate
SMILESO=C(Cn1cnc2ccccc21)O[C@@H]1CCOC1=O
InChIInChI=1S/C13H12N2O4/c16-12(19-11-5-6-18-13(11)17)7-15-8-14-9-3-1-2-4-10(9)15/h1-4,8,11H,5-7H2/t11-/m1/s1
InChIKeyYRMPBISOOYFGME-LLVKDONJSA-N
XLogP0.89
TPSA70.42 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.25
LogP ≤ 50.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate?
The IUPAC name of [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate (CID 25424819) is [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate.
What is the SMILES notation for [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate?
The canonical SMILES for [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate is O=C(Cn1cnc2ccccc21)O[C@@H]1CCOC1=O.
What is the InChIKey of [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate?
The InChIKey is YRMPBISOOYFGME-LLVKDONJSA-N. The full InChI is InChI=1S/C13H12N2O4/c16-12(19-11-5-6-18-13(11)17)7-15-8-14-9-3-1-2-4-10(9)15/h1-4,8,11H,5-7H2/t11-/m1/s1.
What are the key properties of [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate?
[(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate has a molecular weight of 260.25 g/mol, XLogP of 0.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-2-oxooxolan-3-yl] 2-(benzimidazol-1-yl)acetate is sourced from PubChem (CID 25424819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).