C18H14BrClN2OS — CID 25425963
[(4S)-4-(4-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-(4-chlorophenyl)methanone (PubChem CID 25425963) has the molecular formula C18H14BrClN2OS and a molecular weight of 421.75 g/mol. Its IUPAC name is [(4S)-4-(4-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-(4-chlorophenyl)methanone.
| Compound Name | [(4S)-4-(4-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 25425963 |
| Molecular Formula | C18H14BrClN2OS |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | [(4S)-4-(4-bromophenyl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-5-yl]-(4-chlorophenyl)methanone |
| SMILES | CC1=C(C(=O)c2ccc(Cl)cc2)[C@H](c2ccc(Br)cc2)NC(=S)N1 |
| InChI | InChI=1S/C18H14BrClN2OS/c1-10-15(17(23)12-4-8-14(20)9-5-12)16(22-18(24)21-10)11-2-6-13(19)7-3-11/h2-9,16H,1H3,(H2,21,22,24)/t16-/m0/s1 |
| InChIKey | COKJNSWJODVMLF-INIZCTEOSA-N |
| XLogP | 4.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|