About 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 2542664) has the molecular formula C15H12ClN3O3S2
and a molecular weight of 381.87 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
Molecular Properties
| Compound Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| PubChem CID | 2542664 |
| Molecular Formula | C15H12ClN3O3S2 |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2s1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H12ClN3O3S2/c16-9-3-4-12-11(6-9)18-15(24-12)23-8-13(20)19-14(21)17-7-10-2-1-5-22-10/h1-6H,7-8H2,(H2,17,19,20,21) |
| InChIKey | XCQBXJQLQHCUFY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
The IUPAC name of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide (CID 2542664) is 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide.
What is the SMILES notation for 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
The canonical SMILES for 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide is O=C(CSc1nc2cc(Cl)ccc2s1)NC(=O)NCc1ccco1.
What is the InChIKey of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
The InChIKey is XCQBXJQLQHCUFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClN3O3S2/c16-9-3-4-12-11(6-9)18-15(24-12)23-8-13(20)19-14(21)17-7-10-2-1-5-22-10/h1-6H,7-8H2,(H2,17,19,20,21).
What are the key properties of 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide?
2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide has a molecular weight of 381.87 g/mol, XLogP of 3.66, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl]-N-(furan-2-ylmethylcarbamoyl)acetamide is sourced from PubChem (CID 2542664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).