About Carbendazim
Carbendazim (PubChem CID 25429) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl N-(1H-benzimidazol-2-yl)carbamate.
Molecular Properties
| Compound Name | Carbendazim |
| PubChem CID | 25429 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | methyl N-(1H-benzimidazol-2-yl)carbamate |
| SMILES | COC(=O)NC1=NC2=CC=CC=C2N1 |
| InChI | InChI=1S/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13) |
| InChIKey | TWFZGCMQGLPBSX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | 222 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Carbendazim with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Carbendazim?
The IUPAC name of Carbendazim (CID 25429) is methyl N-(1H-benzimidazol-2-yl)carbamate.
What is the SMILES notation for Carbendazim?
The canonical SMILES for Carbendazim is COC(=O)NC1=NC2=CC=CC=C2N1.
What is the InChIKey of Carbendazim?
The InChIKey is TWFZGCMQGLPBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-14-9(13)12-8-10-6-4-2-3-5-7(6)11-8/h2-5H,1H3,(H2,10,11,12,13).
What are the key properties of Carbendazim?
Carbendazim has a molecular weight of 191.19 g/mol, XLogP of 1.50, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Carbendazim is sourced from PubChem (CID 25429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).