About 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one
3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one (PubChem CID 2543134) has the molecular formula C11H8N4O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one.
Molecular Properties
| Compound Name | 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one |
| PubChem CID | 2543134 |
| Molecular Formula | C11H8N4O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one |
| SMILES | Cc1nnc2c3ccccc3ncn2c1=O |
| InChI | InChI=1S/C11H8N4O/c1-7-11(16)15-6-12-9-5-3-2-4-8(9)10(15)14-13-7/h2-6H,1H3 |
| InChIKey | FVUDRIGSNNBYMX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one?
The IUPAC name of 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one (CID 2543134) is 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one.
What is the SMILES notation for 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one?
The canonical SMILES for 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one is Cc1nnc2c3ccccc3ncn2c1=O.
What is the InChIKey of 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one?
The InChIKey is FVUDRIGSNNBYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O/c1-7-11(16)15-6-12-9-5-3-2-4-8(9)10(15)14-13-7/h2-6H,1H3.
What are the key properties of 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one?
3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one has a molecular weight of 212.21 g/mol, XLogP of 0.95, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-[1,2,4]triazino[4,3-c]quinazolin-4-one is sourced from PubChem (CID 2543134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).