C13H12N2O2 — CID 2543250
N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 2543250) has the molecular formula C13H12N2O2 and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 2543250 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | c1cncc(CNc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C13H12N2O2/c1-2-10(7-14-5-1)8-15-11-3-4-12-13(6-11)17-9-16-12/h1-7,15H,8-9H2 |
| InChIKey | OMPJSXOWKKYUGP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|