About N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine
N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 2543250) has the molecular formula C13H12N2O2
and a molecular weight of 228.25 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine.
Molecular Properties
| Compound Name | N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine |
| PubChem CID | 2543250 |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | c1cncc(CNc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C13H12N2O2/c1-2-10(7-14-5-1)8-15-11-3-4-12-13(6-11)17-9-16-12/h1-7,15H,8-9H2 |
| InChIKey | OMPJSXOWKKYUGP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine?
The IUPAC name of N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine (CID 2543250) is N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine.
What is the SMILES notation for N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine?
The canonical SMILES for N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine is c1cncc(CNc2ccc3c(c2)OCO3)c1.
What is the InChIKey of N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine?
The InChIKey is OMPJSXOWKKYUGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O2/c1-2-10(7-14-5-1)8-15-11-3-4-12-13(6-11)17-9-16-12/h1-7,15H,8-9H2.
What are the key properties of N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine?
N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine has a molecular weight of 228.25 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(pyridin-3-ylmethyl)-1,3-benzodioxol-5-amine is sourced from PubChem (CID 2543250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).