C16H11F2N3OS3 — CID 2543427
N-(2,6-difluorophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide (PubChem CID 2543427) has the molecular formula C16H11F2N3OS3 and a molecular weight of 395.48 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-(2,6-difluorophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 2543427 |
| Molecular Formula | C16H11F2N3OS3 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | N-(2,6-difluorophenyl)-2-[(4-phenyl-5-sulfanylidene-1,3,4-thiadiazol-2-yl)sulfanyl]acetamide |
| SMILES | O=C(CSc1nn(-c2ccccc2)c(=S)s1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C16H11F2N3OS3/c17-11-7-4-8-12(18)14(11)19-13(22)9-24-15-20-21(16(23)25-15)10-5-2-1-3-6-10/h1-8H,9H2,(H,19,22) |
| InChIKey | OBHRTPJAHCPLCA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|