C23H20N4O5S — CID 25437116
2-(2,4-dioxoquinazolin-1-yl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]acetamide (PubChem CID 25437116) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is 2-(2,4-dioxoquinazolin-1-yl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-(2,4-dioxoquinazolin-1-yl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 25437116 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 2-(2,4-dioxoquinazolin-1-yl)-N-[3-[methyl(phenyl)sulfamoyl]phenyl]acetamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1cccc(NC(=O)Cn2c(=O)[nH]c(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C23H20N4O5S/c1-26(17-9-3-2-4-10-17)33(31,32)18-11-7-8-16(14-18)24-21(28)15-27-20-13-6-5-12-19(20)22(29)25-23(27)30/h2-14H,15H2,1H3,(H,24,28)(H,25,29,30) |
| InChIKey | SWPCFIHLRTWYNN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |