C19H20Cl2N2O4S — CID 25439683
(2S)-2-(3-chlorophenoxy)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one (PubChem CID 25439683) has the molecular formula C19H20Cl2N2O4S and a molecular weight of 443.35 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one.
| Compound Name | (2S)-2-(3-chlorophenoxy)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 25439683 |
| Molecular Formula | C19H20Cl2N2O4S |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-1-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]propan-1-one |
| SMILES | C[C@H](Oc1cccc(Cl)c1)C(=O)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H20Cl2N2O4S/c1-14(27-17-6-2-4-15(20)12-17)19(24)22-8-10-23(11-9-22)28(25,26)18-7-3-5-16(21)13-18/h2-7,12-14H,8-11H2,1H3/t14-/m0/s1 |
| InChIKey | RJSKPUNDEQRAAC-AWEZNQCLSA-N |
| XLogP | 3.29 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |