C27H32N4O2 — CID 25439831
(2S)-2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-naphthalen-2-ylpropanamide (PubChem CID 25439831) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is (2S)-2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-naphthalen-2-ylpropanamide.
| Compound Name | (2S)-2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 25439831 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (2S)-2-[[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-methylamino]-N-naphthalen-2-ylpropanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc2ccccc2c1)N(C)CC(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O2/c1-21(27(33)28-25-13-12-23-10-6-7-11-24(23)18-25)29(2)20-26(32)31-16-14-30(15-17-31)19-22-8-4-3-5-9-22/h3-13,18,21H,14-17,19-20H2,1-2H3,(H,28,33)/t21-/m0/s1 |
| InChIKey | YNGYDJMILVAQBA-NRFANRHFSA-N |
| XLogP | 3.44 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |