C17H15F4NO4 — CID 2544260
N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide (PubChem CID 2544260) has the molecular formula C17H15F4NO4 and a molecular weight of 373.30 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
|---|---|
| PubChem CID | 2544260 |
| Molecular Formula | C17H15F4NO4 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(2,3,5,6-tetrafluorophenoxy)acetamide |
| SMILES | COc1ccc(CNC(=O)COc2c(F)c(F)cc(F)c2F)cc1OC |
| InChI | InChI=1S/C17H15F4NO4/c1-24-12-4-3-9(5-13(12)25-2)7-22-14(23)8-26-17-15(20)10(18)6-11(19)16(17)21/h3-6H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | FAPPBQUMMQSILD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|