C19H23N3O4S — CID 25443905
4-acetyl-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 25443905) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-acetyl-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 25443905 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 4-acetyl-N-(4-methyl-3-piperidin-1-ylsulfonylphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c[nH]c(C(=O)Nc2ccc(C)c(S(=O)(=O)N3CCCCC3)c2)c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-13-6-7-16(21-19(24)17-10-15(12-20-17)14(2)23)11-18(13)27(25,26)22-8-4-3-5-9-22/h6-7,10-12,20H,3-5,8-9H2,1-2H3,(H,21,24) |
| InChIKey | SASFKFVHIBOPQW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |