About 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine
7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine (PubChem CID 2544769) has the molecular formula C21H16BrN3
and a molecular weight of 390.28 g/mol. Its IUPAC name is 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine |
| PubChem CID | 2544769 |
| Molecular Formula | C21H16BrN3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine |
| SMILES | Cc1ccc(-c2nc3cc(Br)cnc3nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H16BrN3/c1-13-3-7-15(8-4-13)19-20(16-9-5-14(2)6-10-16)25-21-18(24-19)11-17(22)12-23-21/h3-12H,1-2H3 |
| InChIKey | DDOAPVLJUQBFRW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine?
The IUPAC name of 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine (CID 2544769) is 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine.
What is the SMILES notation for 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine?
The canonical SMILES for 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine is Cc1ccc(-c2nc3cc(Br)cnc3nc2-c2ccc(C)cc2)cc1.
What is the InChIKey of 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine?
The InChIKey is DDOAPVLJUQBFRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16BrN3/c1-13-3-7-15(8-4-13)19-20(16-9-5-14(2)6-10-16)25-21-18(24-19)11-17(22)12-23-21/h3-12H,1-2H3.
What are the key properties of 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine?
7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine has a molecular weight of 390.28 g/mol, XLogP of 5.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,3-bis(4-methylphenyl)pyrido[2,3-b]pyrazine is sourced from PubChem (CID 2544769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).