C21H18N2O6 — CID 2544848
[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate (PubChem CID 2544848) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate.
| Compound Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 2544848 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | [2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)OCC(=O)Nc3cc(C)on3)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O6/c1-13-11-19(23-29-13)22-20(25)12-27-21(26)17-5-3-15(4-6-17)16-7-9-18(10-8-16)28-14(2)24/h3-11H,12H2,1-2H3,(H,22,23,25) |
| InChIKey | AZKWZRXZAUTTDC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|