C17H16FN3O3 — CID 2544910
[2-oxo-2-(prop-2-enylamino)ethyl] 2-(2-fluoroanilino)pyridine-3-carboxylate (PubChem CID 2544910) has the molecular formula C17H16FN3O3 and a molecular weight of 329.33 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] 2-(2-fluoroanilino)pyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(2-fluoroanilino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 2544910 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] 2-(2-fluoroanilino)pyridine-3-carboxylate |
| SMILES | C=CCNC(=O)COC(=O)c1cccnc1Nc1ccccc1F |
| InChI | InChI=1S/C17H16FN3O3/c1-2-9-19-15(22)11-24-17(23)12-6-5-10-20-16(12)21-14-8-4-3-7-13(14)18/h2-8,10H,1,9,11H2,(H,19,22)(H,20,21) |
| InChIKey | XDTYSFCGJCFPAJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|