C18H17N5O2 — CID 2545084
[4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl benzoate (PubChem CID 2545084) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl benzoate.
| Compound Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 2545084 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | [4-amino-6-(2-methylanilino)-1,3,5-triazin-2-yl]methyl benzoate |
| SMILES | Cc1ccccc1Nc1nc(N)nc(COC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C18H17N5O2/c1-12-7-5-6-10-14(12)20-18-22-15(21-17(19)23-18)11-25-16(24)13-8-3-2-4-9-13/h2-10H,11H2,1H3,(H3,19,20,21,22,23) |
| InChIKey | WZDPHEXKABQXTB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |