About 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine
4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine (PubChem CID 2545261) has the molecular formula C20H20N4O3S
and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine.
Molecular Properties
| Compound Name | 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine |
| PubChem CID | 2545261 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine |
| SMILES | CCn1c2ccccc2c2nc3cc(S(=O)(=O)N4CCOCC4)ccc3nc21 |
| InChI | InChI=1S/C20H20N4O3S/c1-2-24-18-6-4-3-5-15(18)19-20(24)22-16-8-7-14(13-17(16)21-19)28(25,26)23-9-11-27-12-10-23/h3-8,13H,2,9-12H2,1H3 |
| InChIKey | OILNSNXXFWJZIO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine?
The IUPAC name of 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine (CID 2545261) is 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine.
What is the SMILES notation for 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine?
The canonical SMILES for 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine is CCn1c2ccccc2c2nc3cc(S(=O)(=O)N4CCOCC4)ccc3nc21.
What is the InChIKey of 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine?
The InChIKey is OILNSNXXFWJZIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N4O3S/c1-2-24-18-6-4-3-5-15(18)19-20(24)22-16-8-7-14(13-17(16)21-19)28(25,26)23-9-11-27-12-10-23/h3-8,13H,2,9-12H2,1H3.
What are the key properties of 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine?
4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine has a molecular weight of 396.47 g/mol, XLogP of 2.78, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-ethylindolo[2,3-b]quinoxalin-2-yl)sulfonylmorpholine is sourced from PubChem (CID 2545261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).