C18H19ClN2O5 — CID 2545386
2-(4-chloro-2-methylphenoxy)-N'-[2-(2-methoxyphenoxy)acetyl]acetohydrazide (PubChem CID 2545386) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N'-[2-(2-methoxyphenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N'-[2-(2-methoxyphenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 2545386 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N'-[2-(2-methoxyphenoxy)acetyl]acetohydrazide |
| SMILES | COc1ccccc1OCC(=O)NNC(=O)COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C18H19ClN2O5/c1-12-9-13(19)7-8-14(12)25-10-17(22)20-21-18(23)11-26-16-6-4-3-5-15(16)24-2/h3-9H,10-11H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | IWKHBLQNUCCQLF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|