About (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone
(5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone (PubChem CID 2545462) has the molecular formula C14H9FN2O3
and a molecular weight of 272.24 g/mol. Its IUPAC name is (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone.
Molecular Properties
| Compound Name | (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone |
| PubChem CID | 2545462 |
| Molecular Formula | C14H9FN2O3 |
| Molecular Weight | 272.24 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone |
| SMILES | Cc1noc2ncc(C(=O)c3cc(F)ccc3O)cc12 |
| InChI | InChI=1S/C14H9FN2O3/c1-7-10-4-8(6-16-14(10)20-17-7)13(19)11-5-9(15)2-3-12(11)18/h2-6,18H,1H3 |
| InChIKey | JYEZUXFOCZJKBM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone?
The IUPAC name of (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone (CID 2545462) is (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone.
What is the SMILES notation for (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone?
The canonical SMILES for (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone is Cc1noc2ncc(C(=O)c3cc(F)ccc3O)cc12.
What is the InChIKey of (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone?
The InChIKey is JYEZUXFOCZJKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9FN2O3/c1-7-10-4-8(6-16-14(10)20-17-7)13(19)11-5-9(15)2-3-12(11)18/h2-6,18H,1H3.
What are the key properties of (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone?
(5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone has a molecular weight of 272.24 g/mol, XLogP of 2.61, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-fluoro-2-hydroxyphenyl)-(3-methyl-[1,2]oxazolo[5,4-b]pyridin-5-yl)methanone is sourced from PubChem (CID 2545462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).