C18H16N2O6S — CID 2545598
5-nitro-2-(2,3,5,6-tetramethylphenyl)sulfonylisoindole-1,3-dione (PubChem CID 2545598) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is 5-nitro-2-(2,3,5,6-tetramethylphenyl)sulfonylisoindole-1,3-dione.
| Compound Name | 5-nitro-2-(2,3,5,6-tetramethylphenyl)sulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 2545598 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 5-nitro-2-(2,3,5,6-tetramethylphenyl)sulfonylisoindole-1,3-dione |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2C(=O)c3ccc([N+](=O)[O-])cc3C2=O)c1C |
| InChI | InChI=1S/C18H16N2O6S/c1-9-7-10(2)12(4)16(11(9)3)27(25,26)19-17(21)14-6-5-13(20(23)24)8-15(14)18(19)22/h5-8H,1-4H3 |
| InChIKey | XKKLCHJGMDJJRP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|