C14H17FN4O — CID 25461028
N-(3-ethoxypropyl)-5-(2-fluorophenyl)-1,2,4-triazin-3-amine (PubChem CID 25461028) has the molecular formula C14H17FN4O and a molecular weight of 276.31 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-(2-fluorophenyl)-1,2,4-triazin-3-amine.
| Compound Name | N-(3-ethoxypropyl)-5-(2-fluorophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 25461028 |
| Molecular Formula | C14H17FN4O |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N-(3-ethoxypropyl)-5-(2-fluorophenyl)-1,2,4-triazin-3-amine |
| SMILES | CCOCCCNc1nncc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C14H17FN4O/c1-2-20-9-5-8-16-14-18-13(10-17-19-14)11-6-3-4-7-12(11)15/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,16,18,19) |
| InChIKey | BBIINIZLICFLMN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|