C21H25N3O7S — CID 2546286
[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate (PubChem CID 2546286) has the molecular formula C21H25N3O7S and a molecular weight of 463.51 g/mol. Its IUPAC name is [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate.
| Compound Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 2546286 |
| Molecular Formula | C21H25N3O7S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | [2-(4-methyl-3-nitroanilino)-2-oxoethyl] 3-(diethylsulfamoyl)-4-methylbenzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)Nc2ccc(C)c([N+](=O)[O-])c2)ccc1C |
| InChI | InChI=1S/C21H25N3O7S/c1-5-23(6-2)32(29,30)19-11-16(9-7-15(19)4)21(26)31-13-20(25)22-17-10-8-14(3)18(12-17)24(27)28/h7-12H,5-6,13H2,1-4H3,(H,22,25) |
| InChIKey | XGHZGLJMOPRPQS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|