C15H14BrN3O6S — CID 25467195
(2R)-N-(4-bromophenyl)-2-(2-nitro-4-sulfamoylphenoxy)propanamide (PubChem CID 25467195) has the molecular formula C15H14BrN3O6S and a molecular weight of 444.26 g/mol. Its IUPAC name is (2R)-N-(4-bromophenyl)-2-(2-nitro-4-sulfamoylphenoxy)propanamide.
| Compound Name | (2R)-N-(4-bromophenyl)-2-(2-nitro-4-sulfamoylphenoxy)propanamide |
|---|---|
| PubChem CID | 25467195 |
| Molecular Formula | C15H14BrN3O6S |
| Molecular Weight | 444.26 g/mol |
| Exact Mass | 442.98 |
| IUPAC Name | (2R)-N-(4-bromophenyl)-2-(2-nitro-4-sulfamoylphenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrN3O6S/c1-9(15(20)18-11-4-2-10(16)3-5-11)25-14-7-6-12(26(17,23)24)8-13(14)19(21)22/h2-9H,1H3,(H,18,20)(H2,17,23,24)/t9-/m1/s1 |
| InChIKey | SHOPOTNWTWFKSK-SECBINFHSA-N |
| XLogP | 2.41 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|