C10H13N5OS2 — CID 25468183
N-(2-cyanoethyl)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 25468183) has the molecular formula C10H13N5OS2 and a molecular weight of 283.38 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 25468183 |
| Molecular Formula | C10H13N5OS2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[5-(cyclopropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | N#CCCNC(=O)CSc1nnc(NC2CC2)s1 |
| InChI | InChI=1S/C10H13N5OS2/c11-4-1-5-12-8(16)6-17-10-15-14-9(18-10)13-7-2-3-7/h7H,1-3,5-6H2,(H,12,16)(H,13,14) |
| InChIKey | QCJQYFLZLNDJNU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|