C24H28N4O3S — CID 25468462
2-methyl-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5-piperidin-1-ylsulfonylbenzamide (PubChem CID 25468462) has the molecular formula C24H28N4O3S and a molecular weight of 452.58 g/mol. Its IUPAC name is 2-methyl-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 2-methyl-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 25468462 |
| Molecular Formula | C24H28N4O3S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 2-methyl-N-[(R)-(1-methylimidazol-2-yl)-phenylmethyl]-5-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1C(=O)N[C@H](c1ccccc1)c1nccn1C |
| InChI | InChI=1S/C24H28N4O3S/c1-18-11-12-20(32(30,31)28-14-7-4-8-15-28)17-21(18)24(29)26-22(19-9-5-3-6-10-19)23-25-13-16-27(23)2/h3,5-6,9-13,16-17,22H,4,7-8,14-15H2,1-2H3,(H,26,29)/t22-/m1/s1 |
| InChIKey | MNRTYQJEZVUAKR-JOCHJYFZSA-N |
| XLogP | 3.42 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |