C15H20N4O4S2 — CID 25468521
4-[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-N,N-dimethylbenzenesulfonamide (PubChem CID 25468521) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 25468521 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-[2-[(4-cyclopropyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]ethoxy]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(OCCSc2n[nH]c(=O)n2C2CC2)cc1 |
| InChI | InChI=1S/C15H20N4O4S2/c1-18(2)25(21,22)13-7-5-12(6-8-13)23-9-10-24-15-17-16-14(20)19(15)11-3-4-11/h5-8,11H,3-4,9-10H2,1-2H3,(H,16,20) |
| InChIKey | FGDLJWLMHLIXAU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|