About 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide
4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide (PubChem CID 25468961) has the molecular formula C17H12Cl2FN3O3S
and a molecular weight of 428.27 g/mol. Its IUPAC name is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide |
| PubChem CID | 25468961 |
| Molecular Formula | C17H12Cl2FN3O3S |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)c(F)c1 |
| InChI | InChI=1S/C17H12Cl2FN3O3S/c1-10-2-7-15(14(20)8-10)22-27(25,26)12-5-3-11(4-6-12)23-17(24)16(19)13(18)9-21-23/h2-9,22H,1H3 |
| InChIKey | DCGCIDDFKCQGIF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide?
The IUPAC name of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide (CID 25468961) is 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide.
What is the SMILES notation for 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide?
The canonical SMILES for 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide is Cc1ccc(NS(=O)(=O)c2ccc(-n3ncc(Cl)c(Cl)c3=O)cc2)c(F)c1.
What is the InChIKey of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide?
The InChIKey is DCGCIDDFKCQGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2FN3O3S/c1-10-2-7-15(14(20)8-10)22-27(25,26)12-5-3-11(4-6-12)23-17(24)16(19)13(18)9-21-23/h2-9,22H,1H3.
What are the key properties of 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide?
4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide has a molecular weight of 428.27 g/mol, XLogP of 3.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dichloro-6-oxopyridazin-1-yl)-N-(2-fluoro-4-methylphenyl)benzenesulfonamide is sourced from PubChem (CID 25468961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).