About methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate
methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate (PubChem CID 25469694) has the molecular formula C19H18O6S
and a molecular weight of 374.41 g/mol. Its IUPAC name is methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate |
| PubChem CID | 25469694 |
| Molecular Formula | C19H18O6S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Oc2ccc(C)c3c2C(=O)C[C@@H]3C)c1 |
| InChI | InChI=1S/C19H18O6S/c1-11-7-8-16(18-15(20)9-12(2)17(11)18)25-26(22,23)14-6-4-5-13(10-14)19(21)24-3/h4-8,10,12H,9H2,1-3H3/t12-/m0/s1 |
| InChIKey | OMVRTQRDHFJEEM-LBPRGKRZSA-N |
| XLogP | 3.24 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate?
The IUPAC name of methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate (CID 25469694) is methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate.
What is the SMILES notation for methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate?
The canonical SMILES for methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate is COC(=O)c1cccc(S(=O)(=O)Oc2ccc(C)c3c2C(=O)C[C@@H]3C)c1.
What is the InChIKey of methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate?
The InChIKey is OMVRTQRDHFJEEM-LBPRGKRZSA-N. The full InChI is InChI=1S/C19H18O6S/c1-11-7-8-16(18-15(20)9-12(2)17(11)18)25-26(22,23)14-6-4-5-13(10-14)19(21)24-3/h4-8,10,12H,9H2,1-3H3/t12-/m0/s1.
What are the key properties of methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate?
methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate has a molecular weight of 374.41 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[(1S)-1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl]oxysulfonyl]benzoate is sourced from PubChem (CID 25469694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).