About 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine
5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 2547028) has the molecular formula C19H28N4OS
and a molecular weight of 360.53 g/mol. Its IUPAC name is 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 2547028 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2ncnc(NCC3(N4CCOCC4)CCCCC3)c2c1C |
| InChI | InChI=1S/C19H28N4OS/c1-14-15(2)25-18-16(14)17(21-13-22-18)20-12-19(6-4-3-5-7-19)23-8-10-24-11-9-23/h13H,3-12H2,1-2H3,(H,20,21,22) |
| InChIKey | UPRSPGFGKCPQMK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine (CID 2547028) is 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine is Cc1sc2ncnc(NCC3(N4CCOCC4)CCCCC3)c2c1C.
What is the InChIKey of 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is UPRSPGFGKCPQMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4OS/c1-14-15(2)25-18-16(14)17(21-13-22-18)20-12-19(6-4-3-5-7-19)23-8-10-24-11-9-23/h13H,3-12H2,1-2H3,(H,20,21,22).
What are the key properties of 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine?
5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 360.53 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 2547028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).